About 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one
6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one (PubChem CID 910704) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one |
| PubChem CID | 910704 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one |
| SMILES | [H]/N=c1/n(-c2ccccc2)c(O)cc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C16H13N3O2/c17-16-18(12-7-3-1-4-8-12)14(20)11-15(21)19(16)13-9-5-2-6-10-13/h1-11,17,20H/b17-16- |
| InChIKey | AWTHYBUVAZBHSN-MSUUIHNZSA-N |
| XLogP | 1.81 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one?
The IUPAC name of 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one (CID 910704) is 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one.
What is the SMILES notation for 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one?
The canonical SMILES for 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one is [H]/N=c1/n(-c2ccccc2)c(O)cc(=O)n1-c1ccccc1.
What is the InChIKey of 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one?
The InChIKey is AWTHYBUVAZBHSN-MSUUIHNZSA-N. The full InChI is InChI=1S/C16H13N3O2/c17-16-18(12-7-3-1-4-8-12)14(20)11-15(21)19(16)13-9-5-2-6-10-13/h1-11,17,20H/b17-16-.
What are the key properties of 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one?
6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one has a molecular weight of 279.30 g/mol, XLogP of 1.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2-imino-1,3-diphenylpyrimidin-4-one is sourced from PubChem (CID 910704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).