About 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane
3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane (PubChem CID 91070458) has the molecular formula C22H42O2
and a molecular weight of 338.58 g/mol. Its IUPAC name is 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane.
Molecular Properties
| Compound Name | 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane |
| PubChem CID | 91070458 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane |
| SMILES | CCCCC(CC)COCC=CC=CCOCC(CC)CCCC |
| InChI | InChI=1S/C22H42O2/c1-5-9-15-21(7-3)19-23-17-13-11-12-14-18-24-20-22(8-4)16-10-6-2/h11-14,21-22H,5-10,15-20H2,1-4H3 |
| InChIKey | GJEVDPQBDHUSCA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane?
The IUPAC name of 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane (CID 91070458) is 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane.
What is the SMILES notation for 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane?
The canonical SMILES for 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane is CCCCC(CC)COCC=CC=CCOCC(CC)CCCC.
What is the InChIKey of 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane?
The InChIKey is GJEVDPQBDHUSCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2/c1-5-9-15-21(7-3)19-23-17-13-11-12-14-18-24-20-22(8-4)16-10-6-2/h11-14,21-22H,5-10,15-20H2,1-4H3.
What are the key properties of 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane?
3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane has a molecular weight of 338.58 g/mol, XLogP of 6.56, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(2-ethylhexoxy)hexa-2,4-dienoxymethyl]heptane is sourced from PubChem (CID 91070458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).