About 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 910705) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 910705 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cn3c(n2)CCC3)cc1 |
| InChI | InChI=1S/C12H11N3O2/c16-15(17)10-5-3-9(4-6-10)11-8-14-7-1-2-12(14)13-11/h3-6,8H,1-2,7H2 |
| InChIKey | YJEUKSXNJPGTOE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 910705) is 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is O=[N+]([O-])c1ccc(-c2cn3c(n2)CCC3)cc1.
What is the InChIKey of 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is YJEUKSXNJPGTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c16-15(17)10-5-3-9(4-6-10)11-8-14-7-1-2-12(14)13-11/h3-6,8H,1-2,7H2.
What are the key properties of 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 229.24 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 910705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).