About 4-fluoronaphthalene-1,2-dicarboxamide
4-fluoronaphthalene-1,2-dicarboxamide (PubChem CID 91070556) has the molecular formula C12H9FN2O2
and a molecular weight of 232.21 g/mol. Its IUPAC name is 4-fluoronaphthalene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 4-fluoronaphthalene-1,2-dicarboxamide |
| PubChem CID | 91070556 |
| Molecular Formula | C12H9FN2O2 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 4-fluoronaphthalene-1,2-dicarboxamide |
| SMILES | NC(=O)c1cc(F)c2ccccc2c1C(N)=O |
| InChI | InChI=1S/C12H9FN2O2/c13-9-5-8(11(14)16)10(12(15)17)7-4-2-1-3-6(7)9/h1-5H,(H2,14,16)(H2,15,17) |
| InChIKey | WCEGDTVNGDAVDU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoronaphthalene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoronaphthalene-1,2-dicarboxamide?
The IUPAC name of 4-fluoronaphthalene-1,2-dicarboxamide (CID 91070556) is 4-fluoronaphthalene-1,2-dicarboxamide.
What is the SMILES notation for 4-fluoronaphthalene-1,2-dicarboxamide?
The canonical SMILES for 4-fluoronaphthalene-1,2-dicarboxamide is NC(=O)c1cc(F)c2ccccc2c1C(N)=O.
What is the InChIKey of 4-fluoronaphthalene-1,2-dicarboxamide?
The InChIKey is WCEGDTVNGDAVDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O2/c13-9-5-8(11(14)16)10(12(15)17)7-4-2-1-3-6(7)9/h1-5H,(H2,14,16)(H2,15,17).
What are the key properties of 4-fluoronaphthalene-1,2-dicarboxamide?
4-fluoronaphthalene-1,2-dicarboxamide has a molecular weight of 232.21 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoronaphthalene-1,2-dicarboxamide is sourced from PubChem (CID 91070556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).