About 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde
2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde (PubChem CID 91072545) has the molecular formula C13H13ClN4O
and a molecular weight of 276.73 g/mol. Its IUPAC name is 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde |
| PubChem CID | 91072545 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde |
| SMILES | Cc1ccccc1N(C)c1nc(N)nc(Cl)c1C=O |
| InChI | InChI=1S/C13H13ClN4O/c1-8-5-3-4-6-10(8)18(2)12-9(7-19)11(14)16-13(15)17-12/h3-7H,1-2H3,(H2,15,16,17) |
| InChIKey | HUOZNEQSWUSYOX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde?
The IUPAC name of 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde (CID 91072545) is 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde.
What is the SMILES notation for 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde?
The canonical SMILES for 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde is Cc1ccccc1N(C)c1nc(N)nc(Cl)c1C=O.
What is the InChIKey of 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde?
The InChIKey is HUOZNEQSWUSYOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN4O/c1-8-5-3-4-6-10(8)18(2)12-9(7-19)11(14)16-13(15)17-12/h3-7H,1-2H3,(H2,15,16,17).
What are the key properties of 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde?
2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde has a molecular weight of 276.73 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-chloro-6-(N,2-dimethylanilino)pyrimidine-5-carbaldehyde is sourced from PubChem (CID 91072545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).