C16H24N2O2 — CID 91073447
ethane;1-[(3S,4R)-3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-phenylpyrrolidin-1-yl]ethanone (PubChem CID 91073447) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethane;1-[(3S,4R)-3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-phenylpyrrolidin-1-yl]ethanone.
| Compound Name | ethane;1-[(3S,4R)-3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-phenylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91073447 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethane;1-[(3S,4R)-3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-4-phenylpyrrolidin-1-yl]ethanone |
| SMILES | CC.CC(=O)N1C[C@@H](/C(C)=N\O)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H18N2O2.C2H6/c1-10(15-18)13-8-16(11(2)17)9-14(13)12-6-4-3-5-7-12;1-2/h3-7,13-14,18H,8-9H2,1-2H3;1-2H3/b15-10-;/t13-,14-;/m0./s1 |
| InChIKey | NALXCSLXBTUCHR-GCSZMDFASA-N |
| XLogP | 3.12 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|