C17H10O2 — CID 91073477
15-tetracyclo[8.6.0.02,7.011,16]hexadeca-1(10),2,4,6,8,11(16),12,14-octaenyl formate (PubChem CID 91073477) has the molecular formula C17H10O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 15-tetracyclo[8.6.0.02,7.011,16]hexadeca-1(10),2,4,6,8,11(16),12,14-octaenyl formate.
| Compound Name | 15-tetracyclo[8.6.0.02,7.011,16]hexadeca-1(10),2,4,6,8,11(16),12,14-octaenyl formate |
|---|---|
| PubChem CID | 91073477 |
| Molecular Formula | C17H10O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 15-tetracyclo[8.6.0.02,7.011,16]hexadeca-1(10),2,4,6,8,11(16),12,14-octaenyl formate |
| SMILES | O=COc1cccc2c1-c1c-2ccc2ccccc12 |
| InChI | InChI=1S/C17H10O2/c18-10-19-15-7-3-6-13-14-9-8-11-4-1-2-5-12(11)16(14)17(13)15/h1-10H |
| InChIKey | LGJVFHHYLUBDCB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|