C32H41F6NO4Si — CID 91073694
tert-butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpyrrolidine-1-carboxylate (PubChem CID 91073694) has the molecular formula C32H41F6NO4Si and a molecular weight of 645.76 g/mol. Its IUPAC name is tert-butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91073694 |
| Molecular Formula | C32H41F6NO4Si |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | tert-butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpyrrolidine-1-carboxylate |
| SMILES | C=C(OC1CN(C(=O)OC(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H41F6NO4Si/c1-20(22-15-23(31(33,34)35)17-24(16-22)32(36,37)38)42-26-18-39(28(40)43-29(2,3)4)25(19-41-44(8,9)30(5,6)7)27(26)21-13-11-10-12-14-21/h10-17,25-27H,1,18-19H2,2-9H3 |
| InChIKey | OFNPOBMKDFRPNG-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|