C12H19F3N3O5- — CID 91073991
4-[(methylaminocarbamoylamino)methyl]cyclohexane-1-carboxylic acid;2,2,2-trifluoroacetate (PubChem CID 91073991) has the molecular formula C12H19F3N3O5- and a molecular weight of 342.29 g/mol. Its IUPAC name is 4-[(methylaminocarbamoylamino)methyl]cyclohexane-1-carboxylic acid;2,2,2-trifluoroacetate.
| Compound Name | 4-[(methylaminocarbamoylamino)methyl]cyclohexane-1-carboxylic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91073991 |
| Molecular Formula | C12H19F3N3O5- |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-[(methylaminocarbamoylamino)methyl]cyclohexane-1-carboxylic acid;2,2,2-trifluoroacetate |
| SMILES | CNNC(=O)NCC1CCC(C(=O)O)CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C10H19N3O3.C2HF3O2/c1-11-13-10(16)12-6-7-2-4-8(5-3-7)9(14)15;3-2(4,5)1(6)7/h7-8,11H,2-6H2,1H3,(H,14,15)(H2,12,13,16);(H,6,7)/p-1 |
| InChIKey | JAOKYRMNKYYTFJ-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|