C5H10O3S — CID 91074206
(2S,3S,4S)-2-(hydroxymethyl)thiolane-3,4-diol (PubChem CID 91074206) has the molecular formula C5H10O3S and a molecular weight of 150.20 g/mol. Its IUPAC name is (2S,3S,4S)-2-(hydroxymethyl)thiolane-3,4-diol.
| Compound Name | (2S,3S,4S)-2-(hydroxymethyl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 91074206 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (2S,3S,4S)-2-(hydroxymethyl)thiolane-3,4-diol |
| SMILES | OC[C@@H]1SC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H10O3S/c6-1-4-5(8)3(7)2-9-4/h3-8H,1-2H2/t3-,4+,5+/m1/s1 |
| InChIKey | VLVSFIRYIVAVKW-WISUUJSJSA-N |
| XLogP | -1.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |