C19H28F2NO+ — CID 91074329
8-butyl-3-(2,3-difluorophenyl)-3-methoxy-8-methyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 91074329) has the molecular formula C19H28F2NO+ and a molecular weight of 324.44 g/mol. Its IUPAC name is 8-butyl-3-(2,3-difluorophenyl)-3-methoxy-8-methyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | 8-butyl-3-(2,3-difluorophenyl)-3-methoxy-8-methyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 91074329 |
| Molecular Formula | C19H28F2NO+ |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 8-butyl-3-(2,3-difluorophenyl)-3-methoxy-8-methyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | CCCC[N+]1(C)C2CCC1CC(OC)(c1cccc(F)c1F)C2 |
| InChI | InChI=1S/C19H28F2NO/c1-4-5-11-22(2)14-9-10-15(22)13-19(12-14,23-3)16-7-6-8-17(20)18(16)21/h6-8,14-15H,4-5,9-13H2,1-3H3/q+1 |
| InChIKey | WRKPGQMHLKFNRG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|