C22H46O2Si — CID 91074560
2-(2,2,5,6,7-pentamethyloctan-5-yl)-3-(3-trimethylsilylpropoxy)cyclopropan-1-ol (PubChem CID 91074560) has the molecular formula C22H46O2Si and a molecular weight of 370.69 g/mol. Its IUPAC name is 2-(2,2,5,6,7-pentamethyloctan-5-yl)-3-(3-trimethylsilylpropoxy)cyclopropan-1-ol.
| Compound Name | 2-(2,2,5,6,7-pentamethyloctan-5-yl)-3-(3-trimethylsilylpropoxy)cyclopropan-1-ol |
|---|---|
| PubChem CID | 91074560 |
| Molecular Formula | C22H46O2Si |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | 2-(2,2,5,6,7-pentamethyloctan-5-yl)-3-(3-trimethylsilylpropoxy)cyclopropan-1-ol |
| SMILES | CC(C)C(C)C(C)(CCC(C)(C)C)C1C(O)C1OCCC[Si](C)(C)C |
| InChI | InChI=1S/C22H46O2Si/c1-16(2)17(3)22(7,13-12-21(4,5)6)18-19(23)20(18)24-14-11-15-25(8,9)10/h16-20,23H,11-15H2,1-10H3 |
| InChIKey | SYQBETDACCOEAK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|