C26H32N2O2 — CID 91074864
3,7-dimethyl-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-15-carboxylic acid;ethane (PubChem CID 91074864) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 3,7-dimethyl-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-15-carboxylic acid;ethane.
| Compound Name | 3,7-dimethyl-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-15-carboxylic acid;ethane |
|---|---|
| PubChem CID | 91074864 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 3,7-dimethyl-10,14-diazapentacyclo[12.6.1.02,10.04,9.017,21]henicosa-1(20),2,4(9),5,7,15,17(21),18-octaene-15-carboxylic acid;ethane |
| SMILES | CC.CC.Cc1ccc2c(C)c3n(c2c1)CCCn1c(C(=O)O)cc2cccc-3c21 |
| InChI | InChI=1S/C22H20N2O2.2C2H6/c1-13-7-8-16-14(2)20-17-6-3-5-15-12-19(22(25)26)24(21(15)17)10-4-9-23(20)18(16)11-13;2*1-2/h3,5-8,11-12H,4,9-10H2,1-2H3,(H,25,26);2*1-2H3 |
| InChIKey | GCAIIUASGHVSEJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |