About 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole
5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole (PubChem CID 91074925) has the molecular formula C5H4N10
and a molecular weight of 204.16 g/mol. Its IUPAC name is 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole |
| PubChem CID | 91074925 |
| Molecular Formula | C5H4N10 |
| Molecular Weight | 204.16 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole |
| SMILES | C1=NN=NC1(c1nn[nH]n1)c1ncn[nH]1 |
| InChI | InChI=1S/C5H4N10/c1-5(12-13-7-1,3-6-2-8-9-3)4-10-14-15-11-4/h1-2H,(H,6,8,9)(H,10,11,14,15) |
| InChIKey | IOFGMXSKHLXZFD-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.16 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole?
The IUPAC name of 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole (CID 91074925) is 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole.
What is the SMILES notation for 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole?
The canonical SMILES for 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole is C1=NN=NC1(c1nn[nH]n1)c1ncn[nH]1.
What is the InChIKey of 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole?
The InChIKey is IOFGMXSKHLXZFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N10/c1-5(12-13-7-1,3-6-2-8-9-3)4-10-14-15-11-4/h1-2H,(H,6,8,9)(H,10,11,14,15).
What are the key properties of 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole?
5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole has a molecular weight of 204.16 g/mol, XLogP of -0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1H-1,2,4-triazol-5-yl)triazol-4-yl]-2H-tetrazole is sourced from PubChem (CID 91074925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).