C15H11IO5 — CID 91075614
5,7-dihydroxy-2-(4-hydroxyphenyl)-3-iodo-2,3-dihydrochromen-4-one (PubChem CID 91075614) has the molecular formula C15H11IO5 and a molecular weight of 398.15 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-iodo-2,3-dihydrochromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-iodo-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91075614 |
| Molecular Formula | C15H11IO5 |
| Molecular Weight | 398.15 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-iodo-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccc(O)cc2)C1I |
| InChI | InChI=1S/C15H11IO5/c16-13-14(20)12-10(19)5-9(18)6-11(12)21-15(13)7-1-3-8(17)4-2-7/h1-6,13,15,17-19H |
| InChIKey | LKJPJTLKZSDXDG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|