C22H28N2O6 — CID 91075653
4-[6-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)hexyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol (PubChem CID 91075653) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 4-[6-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)hexyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol.
| Compound Name | 4-[6-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)hexyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol |
|---|---|
| PubChem CID | 91075653 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 4-[6-(3,5-dihydroxy-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindol-4-yl)hexyl]-1a,2,6,6a-tetrahydrooxireno[2,3-f]isoindole-3,5-diol |
| SMILES | Oc1c2c(c(O)n1CCCCCCn1c(O)c3c(c1O)CC1OC1C3)CC1OC1C2 |
| InChI | InChI=1S/C22H28N2O6/c25-19-11-7-15-16(29-15)8-12(11)20(26)23(19)5-3-1-2-4-6-24-21(27)13-9-17-18(30-17)10-14(13)22(24)28/h15-18,25-28H,1-10H2 |
| InChIKey | GPWAILMDKSGENX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|