C23H30FN7O2 — CID 91075808
tert-butyl 4-[[5-(9-ethyl-2-methylpurin-6-yl)-6-fluoro-3-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 91075808) has the molecular formula C23H30FN7O2 and a molecular weight of 455.54 g/mol. Its IUPAC name is tert-butyl 4-[[5-(9-ethyl-2-methylpurin-6-yl)-6-fluoro-3-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(9-ethyl-2-methylpurin-6-yl)-6-fluoro-3-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91075808 |
| Molecular Formula | C23H30FN7O2 |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | tert-butyl 4-[[5-(9-ethyl-2-methylpurin-6-yl)-6-fluoro-3-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | CCn1cnc2c(-c3cc(CN4CCN(C(=O)OC(C)(C)C)CC4)cnc3F)nc(C)nc21 |
| InChI | InChI=1S/C23H30FN7O2/c1-6-30-14-26-19-18(27-15(2)28-21(19)30)17-11-16(12-25-20(17)24)13-29-7-9-31(10-8-29)22(32)33-23(3,4)5/h11-12,14H,6-10,13H2,1-5H3 |
| InChIKey | NQDGFQUEYGBHOC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|