C20H19NO3 — CID 91075811
3,3-dimethyl-1-phenacyl-4H-isoquinoline-7-carboxylic acid (PubChem CID 91075811) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenacyl-4H-isoquinoline-7-carboxylic acid.
| Compound Name | 3,3-dimethyl-1-phenacyl-4H-isoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 91075811 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3,3-dimethyl-1-phenacyl-4H-isoquinoline-7-carboxylic acid |
| SMILES | CC1(C)Cc2ccc(C(=O)O)cc2C(CC(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H19NO3/c1-20(2)12-15-9-8-14(19(23)24)10-16(15)17(21-20)11-18(22)13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | QYBASIFDWMZSNF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |