C15H24F2N4O3 — CID 91075977
N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxoheptan-2-yl]-1,4-oxazepane-4-carboxamide (PubChem CID 91075977) has the molecular formula C15H24F2N4O3 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxoheptan-2-yl]-1,4-oxazepane-4-carboxamide.
| Compound Name | N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxoheptan-2-yl]-1,4-oxazepane-4-carboxamide |
|---|---|
| PubChem CID | 91075977 |
| Molecular Formula | C15H24F2N4O3 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[(2S)-1-[cyano(methyl)amino]-4,4-difluoro-1-oxoheptan-2-yl]-1,4-oxazepane-4-carboxamide |
| SMILES | CCCC(F)(F)C[C@H](NC(=O)N1CCCOCC1)C(=O)N(C)C#N |
| InChI | InChI=1S/C15H24F2N4O3/c1-3-5-15(16,17)10-12(13(22)20(2)11-18)19-14(23)21-6-4-8-24-9-7-21/h12H,3-10H2,1-2H3,(H,19,23)/t12-/m0/s1 |
| InChIKey | WQTGFSFVNALPSA-LBPRGKRZSA-N |
| XLogP | 1.55 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|