C26H31N7O5 — CID 91076019
1-[2-[9,10-dimethoxy-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-1-nitroguanidine (PubChem CID 91076019) has the molecular formula C26H31N7O5 and a molecular weight of 521.58 g/mol. Its IUPAC name is 1-[2-[9,10-dimethoxy-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-1-nitroguanidine.
| Compound Name | 1-[2-[9,10-dimethoxy-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 91076019 |
| Molecular Formula | C26H31N7O5 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 1-[2-[9,10-dimethoxy-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethyl]-1-nitroguanidine |
| SMILES | [H]/N=C(\N)N(CCn1c(=O)n2c(c/c1=N\c1c(C)cc(C)cc1C)-c1cc(OC)c(OC)cc1CC2)[N+](=O)[O-] |
| InChI | InChI=1S/C26H31N7O5/c1-15-10-16(2)24(17(3)11-15)29-23-14-20-19-13-22(38-5)21(37-4)12-18(19)6-7-30(20)26(34)31(23)8-9-32(25(27)28)33(35)36/h10-14H,6-9H2,1-5H3,(H3,27,28)/b29-23+ |
| InChIKey | KDQXMRNNDMXQGJ-BYNJWEBRSA-N |
| XLogP | 2.43 |
| TPSA | 154.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|