C13H11F13O5 — CID 91076129
2,2,2-trifluoroethyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate (PubChem CID 91076129) has the molecular formula C13H11F13O5 and a molecular weight of 494.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate |
|---|---|
| PubChem CID | 91076129 |
| Molecular Formula | C13H11F13O5 |
| Molecular Weight | 494.20 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2,3,3,3-tetrafluoro-2-[1,1,2-trifluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propoxy]acetate |
| SMILES | C=C(F)C(F)(F)OC(C)(F)C(F)(F)OC(F)(COCC(=O)OCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H11F13O5/c1-6(14)11(20,21)30-8(2,15)13(25,26)31-9(16,12(22,23)24)4-28-3-7(27)29-5-10(17,18)19/h1,3-5H2,2H3 |
| InChIKey | ZSGUHFDMONHKRJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |