C18H20ClNO4S — CID 9107617
(E)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(2,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 9107617) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is (E)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(2,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9107617 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (E)-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-20(11-13-6-7-17(19)25-13)18(21)8-5-12-9-15(23-3)16(24-4)10-14(12)22-2/h5-10H,11H2,1-4H3/b8-5+ |
| InChIKey | QHDJASPQAORJOJ-VMPITWQZSA-N |
| XLogP | 4.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|