C20H18F3N3O3S — CID 91076739
11-(aminomethyl)-10-imino-8-methyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one (PubChem CID 91076739) has the molecular formula C20H18F3N3O3S and a molecular weight of 437.44 g/mol. Its IUPAC name is 11-(aminomethyl)-10-imino-8-methyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one.
| Compound Name | 11-(aminomethyl)-10-imino-8-methyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 91076739 |
| Molecular Formula | C20H18F3N3O3S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 11-(aminomethyl)-10-imino-8-methyl-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6-trien-9-one |
| SMILES | [H]/N=C1\C(=O)C2(C)c3ccccc3C(C1CN)N2S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3N3O3S/c1-19-15-5-3-2-4-13(15)17(14(10-24)16(25)18(19)27)26(19)30(28,29)12-8-6-11(7-9-12)20(21,22)23/h2-9,14,17,25H,10,24H2,1H3/b25-16- |
| InChIKey | QJFHZVRZPRUJPE-XYGWBWBKSA-N |
| XLogP | 2.84 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|