About N-ethenyl-N'-methylpropanimidamide
N-ethenyl-N'-methylpropanimidamide (PubChem CID 91077159) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is N-ethenyl-N'-methylpropanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N'-methylpropanimidamide |
| PubChem CID | 91077159 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | N-ethenyl-N'-methylpropanimidamide |
| SMILES | C=CN/C(CC)=N/C |
| InChI | InChI=1S/C6H12N2/c1-4-6(7-3)8-5-2/h5H,2,4H2,1,3H3,(H,7,8) |
| InChIKey | AVKARGMCNZKQAO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N'-methylpropanimidamide?
The IUPAC name of N-ethenyl-N'-methylpropanimidamide (CID 91077159) is N-ethenyl-N'-methylpropanimidamide.
What is the SMILES notation for N-ethenyl-N'-methylpropanimidamide?
The canonical SMILES for N-ethenyl-N'-methylpropanimidamide is C=CN/C(CC)=N/C.
What is the InChIKey of N-ethenyl-N'-methylpropanimidamide?
The InChIKey is AVKARGMCNZKQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-4-6(7-3)8-5-2/h5H,2,4H2,1,3H3,(H,7,8).
What are the key properties of N-ethenyl-N'-methylpropanimidamide?
N-ethenyl-N'-methylpropanimidamide has a molecular weight of 112.18 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N'-methylpropanimidamide is sourced from PubChem (CID 91077159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).