About 1-bromo-3,6-dimethylocta-3,5-dien-2-one
1-bromo-3,6-dimethylocta-3,5-dien-2-one (PubChem CID 91077374) has the molecular formula C10H15BrO
and a molecular weight of 231.13 g/mol. Its IUPAC name is 1-bromo-3,6-dimethylocta-3,5-dien-2-one.
Molecular Properties
| Compound Name | 1-bromo-3,6-dimethylocta-3,5-dien-2-one |
| PubChem CID | 91077374 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-bromo-3,6-dimethylocta-3,5-dien-2-one |
| SMILES | CCC(C)=CC=C(C)C(=O)CBr |
| InChI | InChI=1S/C10H15BrO/c1-4-8(2)5-6-9(3)10(12)7-11/h5-6H,4,7H2,1-3H3 |
| InChIKey | QFTJIVUKLMKDBY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,6-dimethylocta-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,6-dimethylocta-3,5-dien-2-one?
The IUPAC name of 1-bromo-3,6-dimethylocta-3,5-dien-2-one (CID 91077374) is 1-bromo-3,6-dimethylocta-3,5-dien-2-one.
What is the SMILES notation for 1-bromo-3,6-dimethylocta-3,5-dien-2-one?
The canonical SMILES for 1-bromo-3,6-dimethylocta-3,5-dien-2-one is CCC(C)=CC=C(C)C(=O)CBr.
What is the InChIKey of 1-bromo-3,6-dimethylocta-3,5-dien-2-one?
The InChIKey is QFTJIVUKLMKDBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrO/c1-4-8(2)5-6-9(3)10(12)7-11/h5-6H,4,7H2,1-3H3.
What are the key properties of 1-bromo-3,6-dimethylocta-3,5-dien-2-one?
1-bromo-3,6-dimethylocta-3,5-dien-2-one has a molecular weight of 231.13 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,6-dimethylocta-3,5-dien-2-one is sourced from PubChem (CID 91077374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).