C16H16BrN5O2 — CID 91077484
N-[2-amino-3-(methoxymethyl)phenyl]-5-bromo-4-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide (PubChem CID 91077484) has the molecular formula C16H16BrN5O2 and a molecular weight of 390.24 g/mol. Its IUPAC name is N-[2-amino-3-(methoxymethyl)phenyl]-5-bromo-4-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | N-[2-amino-3-(methoxymethyl)phenyl]-5-bromo-4-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91077484 |
| Molecular Formula | C16H16BrN5O2 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[2-amino-3-(methoxymethyl)phenyl]-5-bromo-4-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
| SMILES | COCc1cccc(NC(=O)c2[nH]nc3ncc(Br)c(C)c23)c1N |
| InChI | InChI=1S/C16H16BrN5O2/c1-8-10(17)6-19-15-12(8)14(21-22-15)16(23)20-11-5-3-4-9(7-24-2)13(11)18/h3-6H,7,18H2,1-2H3,(H,20,23)(H,19,21,22) |
| InChIKey | LBFSWGPKOITMQR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|