C22H30N4 — CID 91077529
1,2-diethyl-2,4,16-trimethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene (PubChem CID 91077529) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is 1,2-diethyl-2,4,16-trimethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene.
| Compound Name | 1,2-diethyl-2,4,16-trimethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
|---|---|
| PubChem CID | 91077529 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 1,2-diethyl-2,4,16-trimethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
| SMILES | CCC12CC3N(C)C=CN3c3cccc(c31)N1C=CN(C)C1C2(C)CC |
| InChI | InChI=1S/C22H30N4/c1-6-21(3)20-24(5)12-14-26(20)17-10-8-9-16-19(17)22(21,7-2)15-18-23(4)11-13-25(16)18/h8-14,18,20H,6-7,15H2,1-5H3 |
| InChIKey | NRWUIYFHRHMPHR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |