C25H24FN7OS — CID 91077609
6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(3-methyl-4-thiophen-2-ylphenyl)pyridin-3-amine (PubChem CID 91077609) has the molecular formula C25H24FN7OS and a molecular weight of 489.58 g/mol. Its IUPAC name is 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(3-methyl-4-thiophen-2-ylphenyl)pyridin-3-amine.
| Compound Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(3-methyl-4-thiophen-2-ylphenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 91077609 |
| Molecular Formula | C25H24FN7OS |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-(3-methyl-4-thiophen-2-ylphenyl)pyridin-3-amine |
| SMILES | Cc1cc(Nc2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)nc2)ccc1-c1cccs1 |
| InChI | InChI=1S/C25H24FN7OS/c1-17-13-18(6-7-21(17)23-3-2-12-35-23)30-20-5-4-19(27-14-20)15-29-32-25-28-16-22(26)24(31-25)33-8-10-34-11-9-33/h2-7,12-14,16,30H,8-11,15H2,1H3/b32-29+ |
| InChIKey | SLCOJVWDVSNEEP-UUDCSCGESA-N |
| XLogP | 5.91 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|