About 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane
2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane (PubChem CID 91078285) has the molecular formula C20H31NO2
and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane.
Molecular Properties
| Compound Name | 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane |
| PubChem CID | 91078285 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane |
| SMILES | CC.c1ccc2c(c1)CN(CCC1CCC3(CC1)OCCO3)C2 |
| InChI | InChI=1S/C18H25NO2.C2H6/c1-2-4-17-14-19(13-16(17)3-1)10-7-15-5-8-18(9-6-15)20-11-12-21-18;1-2/h1-4,15H,5-14H2;1-2H3 |
| InChIKey | DAIYZGFLOFIRHY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane?
The IUPAC name of 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane (CID 91078285) is 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane.
What is the SMILES notation for 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane?
The canonical SMILES for 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane is CC.c1ccc2c(c1)CN(CCC1CCC3(CC1)OCCO3)C2.
What is the InChIKey of 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane?
The InChIKey is DAIYZGFLOFIRHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2.C2H6/c1-2-4-17-14-19(13-16(17)3-1)10-7-15-5-8-18(9-6-15)20-11-12-21-18;1-2/h1-4,15H,5-14H2;1-2H3.
What are the key properties of 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane?
2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane has a molecular weight of 317.47 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,4-dioxaspiro[4.5]decan-8-yl)ethyl]-1,3-dihydroisoindole;ethane is sourced from PubChem (CID 91078285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).