About 4,5-diphenylimidazole-1,2-diamine
4,5-diphenylimidazole-1,2-diamine (PubChem CID 910784) has the molecular formula C15H14N4
and a molecular weight of 250.31 g/mol. Its IUPAC name is 4,5-diphenylimidazole-1,2-diamine.
Molecular Properties
| Compound Name | 4,5-diphenylimidazole-1,2-diamine |
| PubChem CID | 910784 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4,5-diphenylimidazole-1,2-diamine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2ccccc2)n1N |
| InChI | InChI=1S/C15H14N4/c16-15-18-13(11-7-3-1-4-8-11)14(19(15)17)12-9-5-2-6-10-12/h1-10H,17H2,(H2,16,18) |
| InChIKey | WXQOHYIZALVTPS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-diphenylimidazole-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenylimidazole-1,2-diamine?
The IUPAC name of 4,5-diphenylimidazole-1,2-diamine (CID 910784) is 4,5-diphenylimidazole-1,2-diamine.
What is the SMILES notation for 4,5-diphenylimidazole-1,2-diamine?
The canonical SMILES for 4,5-diphenylimidazole-1,2-diamine is Nc1nc(-c2ccccc2)c(-c2ccccc2)n1N.
What is the InChIKey of 4,5-diphenylimidazole-1,2-diamine?
The InChIKey is WXQOHYIZALVTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4/c16-15-18-13(11-7-3-1-4-8-11)14(19(15)17)12-9-5-2-6-10-12/h1-10H,17H2,(H2,16,18).
What are the key properties of 4,5-diphenylimidazole-1,2-diamine?
4,5-diphenylimidazole-1,2-diamine has a molecular weight of 250.31 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenylimidazole-1,2-diamine is sourced from PubChem (CID 910784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).