C26H31N3O4 — CID 91078533
ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-quinolin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 91078533) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-quinolin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-quinolin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 91078533 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | ethyl 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-quinolin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(COCCN)N=C2CC(C)(C)CC(=O)C2C1c1cnc2ccccc2c1 |
| InChI | InChI=1S/C26H31N3O4/c1-4-33-25(31)24-20(15-32-10-9-27)29-19-12-26(2,3)13-21(30)23(19)22(24)17-11-16-7-5-6-8-18(16)28-14-17/h5-8,11,14,22-23H,4,9-10,12-13,15,27H2,1-3H3 |
| InChIKey | WQWOVIKPCAHAMX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|