About 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate
2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate (PubChem CID 91079239) has the molecular formula C23H18ClN3O2S
and a molecular weight of 435.94 g/mol. Its IUPAC name is 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate.
Molecular Properties
| Compound Name | 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate |
| PubChem CID | 91079239 |
| Molecular Formula | C23H18ClN3O2S |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate |
| SMILES | Nc1cc(-c2sc(CCOC(=O)c3ccccc3)nc2-c2cccc(Cl)c2)ccn1 |
| InChI | InChI=1S/C23H18ClN3O2S/c24-18-8-4-7-16(13-18)21-22(17-9-11-26-19(25)14-17)30-20(27-21)10-12-29-23(28)15-5-2-1-3-6-15/h1-9,11,13-14H,10,12H2,(H2,25,26) |
| InChIKey | ISTZFIZVTOFPOC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate?
The IUPAC name of 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate (CID 91079239) is 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate.
What is the SMILES notation for 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate?
The canonical SMILES for 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate is Nc1cc(-c2sc(CCOC(=O)c3ccccc3)nc2-c2cccc(Cl)c2)ccn1.
What is the InChIKey of 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate?
The InChIKey is ISTZFIZVTOFPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClN3O2S/c24-18-8-4-7-16(13-18)21-22(17-9-11-26-19(25)14-17)30-20(27-21)10-12-29-23(28)15-5-2-1-3-6-15/h1-9,11,13-14H,10,12H2,(H2,25,26).
What are the key properties of 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate?
2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate has a molecular weight of 435.94 g/mol, XLogP of 5.51, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-amino-4-pyridinyl)-4-(3-chlorophenyl)-1,3-thiazol-2-yl]ethyl benzoate is sourced from PubChem (CID 91079239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).