C18H21N7O2 — CID 91079255
N-ethyl-N-(oxan-4-yl)-4-[3-(2H-tetrazol-5-yl)phenyl]imidazole-1-carboxamide (PubChem CID 91079255) has the molecular formula C18H21N7O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-ethyl-N-(oxan-4-yl)-4-[3-(2H-tetrazol-5-yl)phenyl]imidazole-1-carboxamide.
| Compound Name | N-ethyl-N-(oxan-4-yl)-4-[3-(2H-tetrazol-5-yl)phenyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 91079255 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-ethyl-N-(oxan-4-yl)-4-[3-(2H-tetrazol-5-yl)phenyl]imidazole-1-carboxamide |
| SMILES | CCN(C(=O)n1cnc(-c2cccc(-c3nn[nH]n3)c2)c1)C1CCOCC1 |
| InChI | InChI=1S/C18H21N7O2/c1-2-25(15-6-8-27-9-7-15)18(26)24-11-16(19-12-24)13-4-3-5-14(10-13)17-20-22-23-21-17/h3-5,10-12,15H,2,6-9H2,1H3,(H,20,21,22,23) |
| InChIKey | BHXKUBYBMLOICY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |