C11H18F3NO — CID 91079265
6,6,6-trifluoro-N-methoxy-N-methyl-2-propan-2-ylhexa-1,3-dien-1-amine (PubChem CID 91079265) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is 6,6,6-trifluoro-N-methoxy-N-methyl-2-propan-2-ylhexa-1,3-dien-1-amine.
| Compound Name | 6,6,6-trifluoro-N-methoxy-N-methyl-2-propan-2-ylhexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 91079265 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6,6,6-trifluoro-N-methoxy-N-methyl-2-propan-2-ylhexa-1,3-dien-1-amine |
| SMILES | CON(C)C=C(C=CCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H18F3NO/c1-9(2)10(8-15(3)16-4)6-5-7-11(12,13)14/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | AAWAUJOUXPKWJD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|