C22H21Cl3O3 — CID 91079311
2,2,6,6-tetramethyl-4-[2-methyl-5-(2,4,6-trichlorophenyl)phenyl]oxane-3,5-dione (PubChem CID 91079311) has the molecular formula C22H21Cl3O3 and a molecular weight of 439.77 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[2-methyl-5-(2,4,6-trichlorophenyl)phenyl]oxane-3,5-dione.
| Compound Name | 2,2,6,6-tetramethyl-4-[2-methyl-5-(2,4,6-trichlorophenyl)phenyl]oxane-3,5-dione |
|---|---|
| PubChem CID | 91079311 |
| Molecular Formula | C22H21Cl3O3 |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[2-methyl-5-(2,4,6-trichlorophenyl)phenyl]oxane-3,5-dione |
| SMILES | Cc1ccc(-c2c(Cl)cc(Cl)cc2Cl)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C22H21Cl3O3/c1-11-6-7-12(17-15(24)9-13(23)10-16(17)25)8-14(11)18-19(26)21(2,3)28-22(4,5)20(18)27/h6-10,18H,1-5H3 |
| InChIKey | UULCRLMZJFQDAM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|