About 6-amino-2H-isoindol-1-ol
6-amino-2H-isoindol-1-ol (PubChem CID 91079452) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 6-amino-2H-isoindol-1-ol.
Molecular Properties
| Compound Name | 6-amino-2H-isoindol-1-ol |
| PubChem CID | 91079452 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 6-amino-2H-isoindol-1-ol |
| SMILES | Nc1ccc2c[nH]c(O)c2c1 |
| InChI | InChI=1S/C8H8N2O/c9-6-2-1-5-4-10-8(11)7(5)3-6/h1-4,10-11H,9H2 |
| InChIKey | OQPPULCMIALSSP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2H-isoindol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2H-isoindol-1-ol?
The IUPAC name of 6-amino-2H-isoindol-1-ol (CID 91079452) is 6-amino-2H-isoindol-1-ol.
What is the SMILES notation for 6-amino-2H-isoindol-1-ol?
The canonical SMILES for 6-amino-2H-isoindol-1-ol is Nc1ccc2c[nH]c(O)c2c1.
What is the InChIKey of 6-amino-2H-isoindol-1-ol?
The InChIKey is OQPPULCMIALSSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c9-6-2-1-5-4-10-8(11)7(5)3-6/h1-4,10-11H,9H2.
What are the key properties of 6-amino-2H-isoindol-1-ol?
6-amino-2H-isoindol-1-ol has a molecular weight of 148.16 g/mol, XLogP of 1.46, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2H-isoindol-1-ol is sourced from PubChem (CID 91079452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).