About 7-ethylsulfanyl-2,3-dimethylhept-2-ene
7-ethylsulfanyl-2,3-dimethylhept-2-ene (PubChem CID 91079970) has the molecular formula C11H22S
and a molecular weight of 186.36 g/mol. Its IUPAC name is 7-ethylsulfanyl-2,3-dimethylhept-2-ene.
Molecular Properties
| Compound Name | 7-ethylsulfanyl-2,3-dimethylhept-2-ene |
| PubChem CID | 91079970 |
| Molecular Formula | C11H22S |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 7-ethylsulfanyl-2,3-dimethylhept-2-ene |
| SMILES | CCSCCCCC(C)=C(C)C |
| InChI | InChI=1S/C11H22S/c1-5-12-9-7-6-8-11(4)10(2)3/h5-9H2,1-4H3 |
| InChIKey | UQQYDMACNSCSLP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-ethylsulfanyl-2,3-dimethylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylsulfanyl-2,3-dimethylhept-2-ene?
The IUPAC name of 7-ethylsulfanyl-2,3-dimethylhept-2-ene (CID 91079970) is 7-ethylsulfanyl-2,3-dimethylhept-2-ene.
What is the SMILES notation for 7-ethylsulfanyl-2,3-dimethylhept-2-ene?
The canonical SMILES for 7-ethylsulfanyl-2,3-dimethylhept-2-ene is CCSCCCCC(C)=C(C)C.
What is the InChIKey of 7-ethylsulfanyl-2,3-dimethylhept-2-ene?
The InChIKey is UQQYDMACNSCSLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22S/c1-5-12-9-7-6-8-11(4)10(2)3/h5-9H2,1-4H3.
What are the key properties of 7-ethylsulfanyl-2,3-dimethylhept-2-ene?
7-ethylsulfanyl-2,3-dimethylhept-2-ene has a molecular weight of 186.36 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylsulfanyl-2,3-dimethylhept-2-ene is sourced from PubChem (CID 91079970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).