C27H41NO3 — CID 91080075
(4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methylnona-1,2,4-trienyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide (PubChem CID 91080075) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is (4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methylnona-1,2,4-trienyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide.
| Compound Name | (4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methylnona-1,2,4-trienyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide |
|---|---|
| PubChem CID | 91080075 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methylnona-1,2,4-trienyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide |
| SMILES | CCC(C)C(O)C=CC=C=CNC(=O)C(C)(C)C(O)/C(C)=C\C=C/C=C/C(C)=C(C)C |
| InChI | InChI=1S/C27H41NO3/c1-9-21(4)24(29)18-14-11-15-19-28-26(31)27(7,8)25(30)23(6)17-13-10-12-16-22(5)20(2)3/h10-14,16-19,21,24-25,29-30H,9H2,1-8H3,(H,28,31)/b13-10-,16-12+,18-14?,23-17- |
| InChIKey | PPIPFQGABNXRHM-WPXLPOSUSA-N |
| XLogP | 5.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|