C7H9N3 — CID 91080089
1,2,3,4-tetrahydropyrido[4,3-c]pyridazine (PubChem CID 91080089) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrido[4,3-c]pyridazine.
| Compound Name | 1,2,3,4-tetrahydropyrido[4,3-c]pyridazine |
|---|---|
| PubChem CID | 91080089 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 1,2,3,4-tetrahydropyrido[4,3-c]pyridazine |
| SMILES | c1cc2c(cn1)CCNN2 |
| InChI | InChI=1S/C7H9N3/c1-4-9-10-7-2-3-8-5-6(1)7/h2-3,5,9-10H,1,4H2 |
| InChIKey | IPDGSIHXHOCKEW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |