About 1-(2,6-difluorophenyl)-2,3-difluorobenzene
1-(2,6-difluorophenyl)-2,3-difluorobenzene (PubChem CID 91080743) has the molecular formula C12H6F4
and a molecular weight of 226.17 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-(2,6-difluorophenyl)-2,3-difluorobenzene |
| PubChem CID | 91080743 |
| Molecular Formula | C12H6F4 |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2,3-difluorobenzene |
| SMILES | Fc1cccc(-c2c(F)cccc2F)c1F |
| InChI | InChI=1S/C12H6F4/c13-8-4-2-5-9(14)11(8)7-3-1-6-10(15)12(7)16/h1-6H |
| InChIKey | JMXYWVAXSIEQBJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,6-difluorophenyl)-2,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-difluorophenyl)-2,3-difluorobenzene?
The IUPAC name of 1-(2,6-difluorophenyl)-2,3-difluorobenzene (CID 91080743) is 1-(2,6-difluorophenyl)-2,3-difluorobenzene.
What is the SMILES notation for 1-(2,6-difluorophenyl)-2,3-difluorobenzene?
The canonical SMILES for 1-(2,6-difluorophenyl)-2,3-difluorobenzene is Fc1cccc(-c2c(F)cccc2F)c1F.
What is the InChIKey of 1-(2,6-difluorophenyl)-2,3-difluorobenzene?
The InChIKey is JMXYWVAXSIEQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F4/c13-8-4-2-5-9(14)11(8)7-3-1-6-10(15)12(7)16/h1-6H.
What are the key properties of 1-(2,6-difluorophenyl)-2,3-difluorobenzene?
1-(2,6-difluorophenyl)-2,3-difluorobenzene has a molecular weight of 226.17 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-difluorophenyl)-2,3-difluorobenzene is sourced from PubChem (CID 91080743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).