About 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one
6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one (PubChem CID 91080808) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one.
Molecular Properties
| Compound Name | 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one |
| PubChem CID | 91080808 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one |
| SMILES | Cn1c(O)c2ccc3c(c2cc1=O)CCN3 |
| InChI | InChI=1S/C12H12N2O2/c1-14-11(15)6-9-7-4-5-13-10(7)3-2-8(9)12(14)16/h2-3,6,13,16H,4-5H2,1H3 |
| InChIKey | QIMVKHCWFGGGEX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one?
The IUPAC name of 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one (CID 91080808) is 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one.
What is the SMILES notation for 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one?
The canonical SMILES for 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one is Cn1c(O)c2ccc3c(c2cc1=O)CCN3.
What is the InChIKey of 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one?
The InChIKey is QIMVKHCWFGGGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-14-11(15)6-9-7-4-5-13-10(7)3-2-8(9)12(14)16/h2-3,6,13,16H,4-5H2,1H3.
What are the key properties of 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one?
6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one has a molecular weight of 216.24 g/mol, XLogP of 1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-7-methyl-2,3-dihydro-1H-pyrrolo[3,2-f]isoquinolin-8-one is sourced from PubChem (CID 91080808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).