About 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one
6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one (PubChem CID 91080964) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one.
Molecular Properties
| Compound Name | 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one |
| PubChem CID | 91080964 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one |
| SMILES | O=C1CCCCC(C2COCCOC2=O)O1 |
| InChI | InChI=1S/C11H16O5/c12-10-4-2-1-3-9(16-10)8-7-14-5-6-15-11(8)13/h8-9H,1-7H2 |
| InChIKey | OSRDQTXRLGHCAN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one?
The IUPAC name of 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one (CID 91080964) is 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one.
What is the SMILES notation for 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one?
The canonical SMILES for 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one is O=C1CCCCC(C2COCCOC2=O)O1.
What is the InChIKey of 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one?
The InChIKey is OSRDQTXRLGHCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c12-10-4-2-1-3-9(16-10)8-7-14-5-6-15-11(8)13/h8-9H,1-7H2.
What are the key properties of 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one?
6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one has a molecular weight of 228.24 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(7-oxooxepan-2-yl)-1,4-dioxepan-5-one is sourced from PubChem (CID 91080964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).