C19H26N2O2 — CID 91081531
2-benzyl-5-hexyl-1,3-dihydropyrrolo[3,4-c]pyrrole-4,6-diol (PubChem CID 91081531) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-benzyl-5-hexyl-1,3-dihydropyrrolo[3,4-c]pyrrole-4,6-diol.
| Compound Name | 2-benzyl-5-hexyl-1,3-dihydropyrrolo[3,4-c]pyrrole-4,6-diol |
|---|---|
| PubChem CID | 91081531 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-benzyl-5-hexyl-1,3-dihydropyrrolo[3,4-c]pyrrole-4,6-diol |
| SMILES | CCCCCCn1c(O)c2c(c1O)CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C19H26N2O2/c1-2-3-4-8-11-21-18(22)16-13-20(14-17(16)19(21)23)12-15-9-6-5-7-10-15/h5-7,9-10,22-23H,2-4,8,11-14H2,1H3 |
| InChIKey | CZCXHZMFPMDCDU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|