C20H20N4O2 — CID 91081771
N-(3-ethoxyphenyl)-5,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaene-3-carboxamide (PubChem CID 91081771) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-(3-ethoxyphenyl)-5,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaene-3-carboxamide.
| Compound Name | N-(3-ethoxyphenyl)-5,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaene-3-carboxamide |
|---|---|
| PubChem CID | 91081771 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(3-ethoxyphenyl)-5,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaene-3-carboxamide |
| SMILES | CCOc1cccc(NC(=O)c2c[nH]c3c2-c2ncncc2CCC3)c1 |
| InChI | InChI=1S/C20H20N4O2/c1-2-26-15-7-4-6-14(9-15)24-20(25)16-11-22-17-8-3-5-13-10-21-12-23-19(13)18(16)17/h4,6-7,9-12,22H,2-3,5,8H2,1H3,(H,24,25) |
| InChIKey | BONFPXDNLHONTL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |