C22H18Cl3F3O5 — CID 91082039
methyl 2-[2-[[3,5-dichloro-4-(3-chloro-4,4,4-trifluorobut-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 91082039) has the molecular formula C22H18Cl3F3O5 and a molecular weight of 525.73 g/mol. Its IUPAC name is methyl 2-[2-[[3,5-dichloro-4-(3-chloro-4,4,4-trifluorobut-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[3,5-dichloro-4-(3-chloro-4,4,4-trifluorobut-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 91082039 |
| Molecular Formula | C22H18Cl3F3O5 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | methyl 2-[2-[[3,5-dichloro-4-(3-chloro-4,4,4-trifluorobut-2-enoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COc1cc(Cl)c(OCC=C(Cl)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl3F3O5/c1-30-12-16(21(29)31-2)15-6-4-3-5-13(15)11-33-14-9-17(23)20(18(24)10-14)32-8-7-19(25)22(26,27)28/h3-7,9-10,12H,8,11H2,1-2H3 |
| InChIKey | NJKYDSQJGNXVAG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|