C17H27FN2 — CID 91082091
(2E,4Z)-2-[(3-ethyl-6-fluorohexan-2-ylidene)amino]-8-methylcycloocta-2,4-dien-1-imine (PubChem CID 91082091) has the molecular formula C17H27FN2 and a molecular weight of 278.41 g/mol. Its IUPAC name is (2E,4Z)-2-[(3-ethyl-6-fluorohexan-2-ylidene)amino]-8-methylcycloocta-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-2-[(3-ethyl-6-fluorohexan-2-ylidene)amino]-8-methylcycloocta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 91082091 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (2E,4Z)-2-[(3-ethyl-6-fluorohexan-2-ylidene)amino]-8-methylcycloocta-2,4-dien-1-imine |
| SMILES | [H]/N=C1C(/N=C(\C)C(CC)CCCF)=C\C=C/CCC/1C |
| InChI | InChI=1S/C17H27FN2/c1-4-15(10-8-12-18)14(3)20-16-11-7-5-6-9-13(2)17(16)19/h5,7,11,13,15,19H,4,6,8-10,12H2,1-3H3/b7-5-,16-11+,19-17+,20-14+ |
| InChIKey | SAYNLDJVMWSJDF-RQVQHEQQSA-N |
| XLogP | 5.11 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|