C8H15F7 — CID 91082643
ethane;1,1,1,2,3,3,3-heptafluoro-2-methylpropane (PubChem CID 91082643) has the molecular formula C8H15F7 and a molecular weight of 244.19 g/mol. Its IUPAC name is ethane;1,1,1,2,3,3,3-heptafluoro-2-methylpropane.
| Compound Name | ethane;1,1,1,2,3,3,3-heptafluoro-2-methylpropane |
|---|---|
| PubChem CID | 91082643 |
| Molecular Formula | C8H15F7 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | ethane;1,1,1,2,3,3,3-heptafluoro-2-methylpropane |
| SMILES | CC.CC.CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H3F7.2C2H6/c1-2(5,3(6,7)8)4(9,10)11;2*1-2/h1H3;2*1-2H3 |
| InChIKey | IKQLKLKKCYACAD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |