About 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol
2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol (PubChem CID 91083217) has the molecular formula C7H17NO2S
and a molecular weight of 179.28 g/mol. Its IUPAC name is 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol.
Molecular Properties
| Compound Name | 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol |
| PubChem CID | 91083217 |
| Molecular Formula | C7H17NO2S |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 179.10 |
| IUPAC Name | 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol |
| SMILES | CC(C)SC(C(O)O)N(C)C |
| InChI | InChI=1S/C7H17NO2S/c1-5(2)11-6(7(9)10)8(3)4/h5-7,9-10H,1-4H3 |
| InChIKey | RVZBUESJXLCSJW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol?
The IUPAC name of 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol (CID 91083217) is 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol.
What is the SMILES notation for 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol?
The canonical SMILES for 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol is CC(C)SC(C(O)O)N(C)C.
What is the InChIKey of 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol?
The InChIKey is RVZBUESJXLCSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO2S/c1-5(2)11-6(7(9)10)8(3)4/h5-7,9-10H,1-4H3.
What are the key properties of 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol?
2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol has a molecular weight of 179.28 g/mol, XLogP of 0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-2-propan-2-ylsulfanylethane-1,1-diol is sourced from PubChem (CID 91083217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).