About (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane
(1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane (PubChem CID 91084331) has the molecular formula C11H18BNOS
and a molecular weight of 223.15 g/mol. Its IUPAC name is (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane.
Molecular Properties
| Compound Name | (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane |
| PubChem CID | 91084331 |
| Molecular Formula | C11H18BNOS |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane |
| SMILES | CB1OC(CN)c2ccccc21.CSC |
| InChI | InChI=1S/C9H12BNO.C2H6S/c1-10-8-5-3-2-4-7(8)9(6-11)12-10;1-3-2/h2-5,9H,6,11H2,1H3;1-2H3 |
| InChIKey | KHOXCBQDTZEPOG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane?
The IUPAC name of (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane (CID 91084331) is (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane.
What is the SMILES notation for (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane?
The canonical SMILES for (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane is CB1OC(CN)c2ccccc21.CSC.
What is the InChIKey of (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane?
The InChIKey is KHOXCBQDTZEPOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BNO.C2H6S/c1-10-8-5-3-2-4-7(8)9(6-11)12-10;1-3-2/h2-5,9H,6,11H2,1H3;1-2H3.
What are the key properties of (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane?
(1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane has a molecular weight of 223.15 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3H-2,1-benzoxaborol-3-yl)methanamine;methylsulfanylmethane is sourced from PubChem (CID 91084331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).