C17H15F3N4O — CID 91084378
5-methoxy-N-[1H-pyrazol-4-yl-[2-(trifluoromethyl)phenyl]methyl]pyridin-2-amine (PubChem CID 91084378) has the molecular formula C17H15F3N4O and a molecular weight of 348.33 g/mol. Its IUPAC name is 5-methoxy-N-[1H-pyrazol-4-yl-[2-(trifluoromethyl)phenyl]methyl]pyridin-2-amine.
| Compound Name | 5-methoxy-N-[1H-pyrazol-4-yl-[2-(trifluoromethyl)phenyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 91084378 |
| Molecular Formula | C17H15F3N4O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-methoxy-N-[1H-pyrazol-4-yl-[2-(trifluoromethyl)phenyl]methyl]pyridin-2-amine |
| SMILES | COc1ccc(NC(c2cn[nH]c2)c2ccccc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C17H15F3N4O/c1-25-12-6-7-15(21-10-12)24-16(11-8-22-23-9-11)13-4-2-3-5-14(13)17(18,19)20/h2-10,16H,1H3,(H,21,24)(H,22,23) |
| InChIKey | XOULRHKRWWQEMW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |